C22H17ClN4O2S — CID 3947725
2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide (PubChem CID 3947725) has the molecular formula C22H17ClN4O2S and a molecular weight of 436.92 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide |
|---|---|
| PubChem CID | 3947725 |
| Molecular Formula | C22H17ClN4O2S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N',N'-diphenylacetohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)o1)NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17ClN4O2S/c23-17-13-11-16(12-14-17)21-24-25-22(29-21)30-15-20(28)26-27(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14H,15H2,(H,26,28) |
| InChIKey | PEFFYBYTSVDRBI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|