C16H13ClN4O2S — CID 56735774
2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide (PubChem CID 56735774) has the molecular formula C16H13ClN4O2S and a molecular weight of 360.83 g/mol. Its IUPAC name is 2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 56735774 |
| Molecular Formula | C16H13ClN4O2S |
| Molecular Weight | 360.83 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
| SMILES | Nc1ccc(-c2nnc(SCC(=O)Nc3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C16H13ClN4O2S/c17-11-3-7-13(8-4-11)19-14(22)9-24-16-21-20-15(23-16)10-1-5-12(18)6-2-10/h1-8H,9,18H2,(H,19,22) |
| InChIKey | ZKMGVJNDNOVJRV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|