C20H19ClN4O2S — CID 4234258
2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 4234258) has the molecular formula C20H19ClN4O2S and a molecular weight of 414.92 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4234258 |
| Molecular Formula | C20H19ClN4O2S |
| Molecular Weight | 414.92 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)o1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C20H19ClN4O2S/c21-15-5-3-14(4-6-15)19-23-24-20(27-19)28-13-18(26)22-16-7-9-17(10-8-16)25-11-1-2-12-25/h3-10H,1-2,11-13H2,(H,22,26) |
| InChIKey | GGNFKBARWCQVGB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|