C21H22BrN5O2S — CID 4310456
2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 4310456) has the molecular formula C21H22BrN5O2S and a molecular weight of 488.41 g/mol. Its IUPAC name is 2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4310456 |
| Molecular Formula | C21H22BrN5O2S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CSc3nnc(-c4ccc(Br)cc4)o3)cc2)CC1 |
| InChI | InChI=1S/C21H22BrN5O2S/c1-26-10-12-27(13-11-26)18-8-6-17(7-9-18)23-19(28)14-30-21-25-24-20(29-21)15-2-4-16(22)5-3-15/h2-9H,10-14H2,1H3,(H,23,28) |
| InChIKey | VFAPPYZBOTWHAW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|