C24H27N5O4S — CID 3550150
N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3550150) has the molecular formula C24H27N5O4S and a molecular weight of 481.58 g/mol. Its IUPAC name is N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3550150 |
| Molecular Formula | C24H27N5O4S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | N-[4-(4-acetylpiperazin-1-yl)phenyl]-2-[[5-(4-ethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(-c2nnc(SCC(=O)Nc3ccc(N4CCN(C(C)=O)CC4)cc3)o2)cc1 |
| InChI | InChI=1S/C24H27N5O4S/c1-3-32-21-10-4-18(5-11-21)23-26-27-24(33-23)34-16-22(31)25-19-6-8-20(9-7-19)29-14-12-28(13-15-29)17(2)30/h4-11H,3,12-16H2,1-2H3,(H,25,31) |
| InChIKey | OBHKMEJIXAWLOY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|