C29H29N5O5S — CID 3559847
N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 3559847) has the molecular formula C29H29N5O5S and a molecular weight of 559.65 g/mol. Its IUPAC name is N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 3559847 |
| Molecular Formula | C29H29N5O5S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(NC(=O)CSc4nnc(-c5ccc(OC)cc5)o4)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H29N5O5S/c1-37-24-11-3-20(4-12-24)27-31-32-29(39-27)40-19-26(35)30-22-7-9-23(10-8-22)33-15-17-34(18-16-33)28(36)21-5-13-25(38-2)14-6-21/h3-14H,15-19H2,1-2H3,(H,30,35) |
| InChIKey | AZKOOYQVEONRPF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|