C28H26ClN5O4S — CID 3249670
2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3249670) has the molecular formula C28H26ClN5O4S and a molecular weight of 564.07 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3249670 |
| Molecular Formula | C28H26ClN5O4S |
| Molecular Weight | 564.07 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-[4-[4-(4-methoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(NC(=O)CSc4nnc(-c5ccccc5Cl)o4)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H26ClN5O4S/c1-37-22-12-6-19(7-13-22)27(36)34-16-14-33(15-17-34)21-10-8-20(9-11-21)30-25(35)18-39-28-32-31-26(38-28)23-4-2-3-5-24(23)29/h2-13H,14-18H2,1H3,(H,30,35) |
| InChIKey | CBFOEWXZLYSUOY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.07 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|