C32H29N5O4S — CID 3889843
N-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 3889843) has the molecular formula C32H29N5O4S and a molecular weight of 579.68 g/mol. Its IUPAC name is N-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3889843 |
| Molecular Formula | C32H29N5O4S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | N-[4-[4-(2-methoxybenzoyl)piperazin-1-yl]phenyl]-2-[(5-naphthalen-1-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)CSc3nnc(-c4cccc5ccccc45)o3)cc2)CC1 |
| InChI | InChI=1S/C32H29N5O4S/c1-40-28-12-5-4-10-27(28)31(39)37-19-17-36(18-20-37)24-15-13-23(14-16-24)33-29(38)21-42-32-35-34-30(41-32)26-11-6-8-22-7-2-3-9-25(22)26/h2-16H,17-21H2,1H3,(H,33,38) |
| InChIKey | YFOIDQXQCFQJOX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|