C28H27N5O3S — CID 4556834
N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 4556834) has the molecular formula C28H27N5O3S and a molecular weight of 513.62 g/mol. Its IUPAC name is N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4556834 |
| Molecular Formula | C28H27N5O3S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | N-[4-[4-(2-methylbenzoyl)piperazin-1-yl]phenyl]-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)CSc3nnc(-c4ccccc4)o3)cc2)CC1 |
| InChI | InChI=1S/C28H27N5O3S/c1-20-7-5-6-10-24(20)27(35)33-17-15-32(16-18-33)23-13-11-22(12-14-23)29-25(34)19-37-28-31-30-26(36-28)21-8-3-2-4-9-21/h2-14H,15-19H2,1H3,(H,29,34) |
| InChIKey | UCABOXLNLKEKOR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|