C23H24FN5O3S — CID 3933864
2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3933864) has the molecular formula C23H24FN5O3S and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3933864 |
| Molecular Formula | C23H24FN5O3S |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanyl]-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | CCc1nnc(SCC(=O)Nc2ccc(N3CCN(C(=O)c4ccccc4F)CC3)cc2)o1 |
| InChI | InChI=1S/C23H24FN5O3S/c1-2-21-26-27-23(32-21)33-15-20(30)25-16-7-9-17(10-8-16)28-11-13-29(14-12-28)22(31)18-5-3-4-6-19(18)24/h3-10H,2,11-15H2,1H3,(H,25,30) |
| InChIKey | BKFDBCKPKBSZOE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|