C22H23FN4O2S2 — CID 3670644
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3670644) has the molecular formula C22H23FN4O2S2 and a molecular weight of 458.58 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3670644 |
| Molecular Formula | C22H23FN4O2S2 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | O=C(CSC1=NCCS1)Nc1ccc(N2CCN(C(=O)c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C22H23FN4O2S2/c23-19-4-2-1-3-18(19)21(29)27-12-10-26(11-13-27)17-7-5-16(6-8-17)25-20(28)15-31-22-24-9-14-30-22/h1-8H,9-15H2,(H,25,28) |
| InChIKey | OSYHSOLYURJTKA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|