C16H22N4O3S3 — CID 4546501
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide (PubChem CID 4546501) has the molecular formula C16H22N4O3S3 and a molecular weight of 414.58 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4546501 |
| Molecular Formula | C16H22N4O3S3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(NC(=O)CSC3=NCCS3)cc2)CC1 |
| InChI | InChI=1S/C16H22N4O3S3/c1-26(22,23)20-9-7-19(8-10-20)14-4-2-13(3-5-14)18-15(21)12-25-16-17-6-11-24-16/h2-5H,6-12H2,1H3,(H,18,21) |
| InChIKey | DGZACDYDDPRZNE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|