C17H22N4O3S3 — CID 4238927
N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide (PubChem CID 4238927) has the molecular formula C17H22N4O3S3 and a molecular weight of 426.59 g/mol. Its IUPAC name is N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4238927 |
| Molecular Formula | C17H22N4O3S3 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]acetamide |
| SMILES | Cc1csc(SCC(=O)Nc2ccc(N3CCN(S(C)(=O)=O)CC3)cc2)n1 |
| InChI | InChI=1S/C17H22N4O3S3/c1-13-11-25-17(18-13)26-12-16(22)19-14-3-5-15(6-4-14)20-7-9-21(10-8-20)27(2,23)24/h3-6,11H,7-10,12H2,1-2H3,(H,19,22) |
| InChIKey | BZBFGCIOHSDMFY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|