C25H28N4O3S2 — CID 16899406
2-[[4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide (PubChem CID 16899406) has the molecular formula C25H28N4O3S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 2-[[4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[[4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16899406 |
| Molecular Formula | C25H28N4O3S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-[[4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,3-thiazol-2-yl]sulfanyl]-N-(4-methylphenyl)acetamide |
| SMILES | COc1ccc(N2CCN(C(=O)Cc3csc(SCC(=O)Nc4ccc(C)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O3S2/c1-18-3-5-19(6-4-18)26-23(30)17-34-25-27-20(16-33-25)15-24(31)29-13-11-28(12-14-29)21-7-9-22(32-2)10-8-21/h3-10,16H,11-15,17H2,1-2H3,(H,26,30) |
| InChIKey | IOTJCHIPXSHBKZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|