C23H24BrN3O2S2 — CID 16900055
2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 16900055) has the molecular formula C23H24BrN3O2S2 and a molecular weight of 518.50 g/mol. Its IUPAC name is 2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 16900055 |
| Molecular Formula | C23H24BrN3O2S2 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 2-[2-[(4-bromophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)Cc3csc(SCc4ccc(Br)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C23H24BrN3O2S2/c1-29-21-8-6-20(7-9-21)26-10-12-27(13-11-26)22(28)14-19-16-31-23(25-19)30-15-17-2-4-18(24)5-3-17/h2-9,16H,10-15H2,1H3 |
| InChIKey | SAVROCKDFFIZHQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|