C19H30N4O4S2 — CID 134064822
N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-(2-morpholin-4-ylethylsulfanyl)acetamide (PubChem CID 134064822) has the molecular formula C19H30N4O4S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-(2-morpholin-4-ylethylsulfanyl)acetamide.
| Compound Name | N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-(2-morpholin-4-ylethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 134064822 |
| Molecular Formula | C19H30N4O4S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]-2-(2-morpholin-4-ylethylsulfanyl)acetamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(NC(=O)CSCCN3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C19H30N4O4S2/c1-29(25,26)23-8-6-22(7-9-23)18-4-2-17(3-5-18)20-19(24)16-28-15-12-21-10-13-27-14-11-21/h2-5H,6-16H2,1H3,(H,20,24) |
| InChIKey | JPFPPAJIPZRHGQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|