C15H21N3O4S — CID 90513233
1-methylsulfonyl-N-(4-morpholin-4-ylphenyl)azetidine-3-carboxamide (PubChem CID 90513233) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(4-morpholin-4-ylphenyl)azetidine-3-carboxamide.
| Compound Name | 1-methylsulfonyl-N-(4-morpholin-4-ylphenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513233 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-methylsulfonyl-N-(4-morpholin-4-ylphenyl)azetidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CC(C(=O)Nc2ccc(N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C15H21N3O4S/c1-23(20,21)18-10-12(11-18)15(19)16-13-2-4-14(5-3-13)17-6-8-22-9-7-17/h2-5,12H,6-11H2,1H3,(H,16,19) |
| InChIKey | HRSQZHVWNFRMBW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|