C22H25N3O4 — CID 25332767
(3S)-1-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 25332767) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (3S)-1-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 25332767 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (3S)-1-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COc1cccc(N2C[C@@H](C(=O)Nc3ccc(N4CCOCC4)cc3)CC2=O)c1 |
| InChI | InChI=1S/C22H25N3O4/c1-28-20-4-2-3-19(14-20)25-15-16(13-21(25)26)22(27)23-17-5-7-18(8-6-17)24-9-11-29-12-10-24/h2-8,14,16H,9-13,15H2,1H3,(H,23,27)/t16-/m0/s1 |
| InChIKey | BNSDHVXXTRBLDO-INIZCTEOSA-N |
| XLogP | 2.52 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|