C23H25N3O5 — CID 42955805
1-(3-methoxyphenyl)-5-oxo-N-[4-(oxolane-2-carbonylamino)phenyl]pyrrolidine-3-carboxamide (PubChem CID 42955805) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-5-oxo-N-[4-(oxolane-2-carbonylamino)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-methoxyphenyl)-5-oxo-N-[4-(oxolane-2-carbonylamino)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42955805 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-(3-methoxyphenyl)-5-oxo-N-[4-(oxolane-2-carbonylamino)phenyl]pyrrolidine-3-carboxamide |
| SMILES | COc1cccc(N2CC(C(=O)Nc3ccc(NC(=O)C4CCCO4)cc3)CC2=O)c1 |
| InChI | InChI=1S/C23H25N3O5/c1-30-19-5-2-4-18(13-19)26-14-15(12-21(26)27)22(28)24-16-7-9-17(10-8-16)25-23(29)20-6-3-11-31-20/h2,4-5,7-10,13,15,20H,3,6,11-12,14H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | LPBAGYPXJBXCBO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |