C17H25N3O3S — CID 55831217
2-morpholin-4-yl-N-[4-[(2-propylsulfanylacetyl)amino]phenyl]acetamide (PubChem CID 55831217) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-[4-[(2-propylsulfanylacetyl)amino]phenyl]acetamide.
| Compound Name | 2-morpholin-4-yl-N-[4-[(2-propylsulfanylacetyl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 55831217 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-morpholin-4-yl-N-[4-[(2-propylsulfanylacetyl)amino]phenyl]acetamide |
| SMILES | CCCSCC(=O)Nc1ccc(NC(=O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C17H25N3O3S/c1-2-11-24-13-17(22)19-15-5-3-14(4-6-15)18-16(21)12-20-7-9-23-10-8-20/h3-6H,2,7-13H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | IXTJVNXSNISDRT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|