C18H24N4O2S2 — CID 3435498
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide (PubChem CID 3435498) has the molecular formula C18H24N4O2S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3435498 |
| Molecular Formula | C18H24N4O2S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-propanoylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCC(=O)N1CCN(c2ccc(NC(=O)CSC3=NCCS3)cc2)CC1 |
| InChI | InChI=1S/C18H24N4O2S2/c1-2-17(24)22-10-8-21(9-11-22)15-5-3-14(4-6-15)20-16(23)13-26-18-19-7-12-25-18/h3-6H,2,7-13H2,1H3,(H,20,23) |
| InChIKey | CDQBUQHDWSYXGW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|