C18H24N4OS2 — CID 3886802
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide (PubChem CID 3886802) has the molecular formula C18H24N4OS2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3886802 |
| Molecular Formula | C18H24N4OS2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
| SMILES | C=CCN1CCN(c2ccc(NC(=O)CSC3=NCCS3)cc2)CC1 |
| InChI | InChI=1S/C18H24N4OS2/c1-2-8-21-9-11-22(12-10-21)16-5-3-15(4-6-16)20-17(23)14-25-18-19-7-13-24-18/h2-6H,1,7-14H2,(H,20,23) |
| InChIKey | DOIJNANBDZUHGY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|