C28H30N5O3S2+ — CID 6382477
2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide (PubChem CID 6382477) has the molecular formula C28H30N5O3S2+ and a molecular weight of 548.71 g/mol. Its IUPAC name is 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 6382477 |
| Molecular Formula | C28H30N5O3S2+ |
| Molecular Weight | 548.71 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-[[3-(benzenesulfonyl)-1H-benzimidazol-3-ium-2-yl]sulfanyl]-N-[4-(4-prop-2-enylpiperazin-1-yl)phenyl]acetamide |
| SMILES | C=CCN1CCN(c2ccc(NC(=O)CSc3[nH]c4ccccc4[n+]3S(=O)(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H29N5O3S2/c1-2-16-31-17-19-32(20-18-31)23-14-12-22(13-15-23)29-27(34)21-37-28-30-25-10-6-7-11-26(25)33(28)38(35,36)24-8-4-3-5-9-24/h2-15H,1,16-21H2,(H,29,34)/p+1 |
| InChIKey | RAHSNSORKBGVKX-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.71 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|