C27H27BrN5O2S+ — CID 4538405
N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide (PubChem CID 4538405) has the molecular formula C27H27BrN5O2S+ and a molecular weight of 565.52 g/mol. Its IUPAC name is N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4538405 |
| Molecular Formula | C27H27BrN5O2S+ |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | N-[4-[4-(4-bromobenzoyl)piperazin-1-yl]phenyl]-2-[(3-methyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]acetamide |
| SMILES | C[n+]1c(SCC(=O)Nc2ccc(N3CCN(C(=O)c4ccc(Br)cc4)CC3)cc2)[nH]c2ccccc21 |
| InChI | InChI=1S/C27H26BrN5O2S/c1-31-24-5-3-2-4-23(24)30-27(31)36-18-25(34)29-21-10-12-22(13-11-21)32-14-16-33(17-15-32)26(35)19-6-8-20(28)9-7-19/h2-13H,14-18H2,1H3,(H,29,34)/p+1 |
| InChIKey | BWWGEZZJXGJTPL-UHFFFAOYSA-O |
| XLogP | 4.45 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|