C33H31FN5O2S+ — CID 4520818
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 4520818) has the molecular formula C33H31FN5O2S+ and a molecular weight of 580.71 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 4520818 |
| Molecular Formula | C33H31FN5O2S+ |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-[4-[4-(4-fluorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | O=C(CSc1[nH]c2ccccc2[n+]1Cc1ccccc1)Nc1ccc(N2CCN(C(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H30FN5O2S/c34-26-12-10-25(11-13-26)32(41)38-20-18-37(19-21-38)28-16-14-27(15-17-28)35-31(40)23-42-33-36-29-8-4-5-9-30(29)39(33)22-24-6-2-1-3-7-24/h1-17H,18-23H2,(H,35,40)/p+1 |
| InChIKey | VAEZRNRWNIDWBN-UHFFFAOYSA-O |
| XLogP | 5.34 |
| TPSA | 72.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|