C24H24N3O3S+ — CID 4560480
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide (PubChem CID 4560480) has the molecular formula C24H24N3O3S+ and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4560480 |
| Molecular Formula | C24H24N3O3S+ |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CSc2[nH]c3ccccc3[n+]2Cc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C24H23N3O3S/c1-29-19-12-18(13-20(14-19)30-2)25-23(28)16-31-24-26-21-10-6-7-11-22(21)27(24)15-17-8-4-3-5-9-17/h3-14H,15-16H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | MPVRGESJUDSHRF-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|