C23H22N3O2S+ — CID 4563019
2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3-methoxyphenyl)acetamide (PubChem CID 4563019) has the molecular formula C23H22N3O2S+ and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4563019 |
| Molecular Formula | C23H22N3O2S+ |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[(3-benzyl-1H-benzimidazol-3-ium-2-yl)sulfanyl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CSc2[nH]c3ccccc3[n+]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H21N3O2S/c1-28-19-11-7-10-18(14-19)24-22(27)16-29-23-25-20-12-5-6-13-21(20)26(23)15-17-8-3-2-4-9-17/h2-14H,15-16H2,1H3,(H,24,27)/p+1 |
| InChIKey | SLRSNHJZXTVZDZ-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|