C15H14BrNO2S — CID 92513721
2-(2-bromophenyl)sulfanyl-N-(3-methoxyphenyl)acetamide (PubChem CID 92513721) has the molecular formula C15H14BrNO2S and a molecular weight of 352.25 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanyl-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-(2-bromophenyl)sulfanyl-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 92513721 |
| Molecular Formula | C15H14BrNO2S |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-(2-bromophenyl)sulfanyl-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CSc2ccccc2Br)c1 |
| InChI | InChI=1S/C15H14BrNO2S/c1-19-12-6-4-5-11(9-12)17-15(18)10-20-14-8-3-2-7-13(14)16/h2-9H,10H2,1H3,(H,17,18) |
| InChIKey | RXTCDLYOWKVGJN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |