C24H21FN2O5S — CID 42104493
[2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42104493) has the molecular formula C24H21FN2O5S and a molecular weight of 468.51 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42104493 |
| Molecular Formula | C24H21FN2O5S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-methoxyanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COc1cccc(NC(=O)CSc2ccccc2C(=O)OCC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C24H21FN2O5S/c1-31-19-9-5-8-18(13-19)27-23(29)15-33-21-11-3-2-10-20(21)24(30)32-14-22(28)26-17-7-4-6-16(25)12-17/h2-13H,14-15H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | IQHHNZCCWYYDRM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |