C23H18F2N2O4S — CID 29142837
[2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 29142837) has the molecular formula C23H18F2N2O4S and a molecular weight of 456.47 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 29142837 |
| Molecular Formula | C23H18F2N2O4S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 2-[2-(3-fluoroanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1SCC(=O)Nc1cccc(F)c1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C23H18F2N2O4S/c24-15-5-3-7-17(11-15)26-21(28)13-31-23(30)19-9-1-2-10-20(19)32-14-22(29)27-18-8-4-6-16(25)12-18/h1-12H,13-14H2,(H,26,28)(H,27,29) |
| InChIKey | FQNIENWQKUMBOD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |