C24H17FN2O4S — CID 42106587
[2-(4-fluorophenyl)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42106587) has the molecular formula C24H17FN2O4S and a molecular weight of 448.48 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42106587 |
| Molecular Formula | C24H17FN2O4S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | N#Cc1cccc(NC(=O)CSc2ccccc2C(=O)OCC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H17FN2O4S/c25-18-10-8-17(9-11-18)21(28)14-31-24(30)20-6-1-2-7-22(20)32-15-23(29)27-19-5-3-4-16(12-19)13-26/h1-12H,14-15H2,(H,27,29) |
| InChIKey | QDTYAXRUTAFTNH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |