C23H19N3O2S — CID 9336970
N-benzyl-2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 9336970) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-benzyl-2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-benzyl-2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 9336970 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-benzyl-2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | N#Cc1cccc(NC(=O)CSc2ccccc2C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H19N3O2S/c24-14-18-9-6-10-19(13-18)26-22(27)16-29-21-12-5-4-11-20(21)23(28)25-15-17-7-2-1-3-8-17/h1-13H,15-16H2,(H,25,28)(H,26,27) |
| InChIKey | DGEYYKZCFURTCA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |