C25H21N3O5S — CID 42106602
[2-(3-methoxyanilino)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 42106602) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 42106602 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | COc1cccc(NC(=O)COC(=O)c2ccccc2SCC(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C25H21N3O5S/c1-32-20-9-5-8-19(13-20)27-23(29)15-33-25(31)21-10-2-3-11-22(21)34-16-24(30)28-18-7-4-6-17(12-18)14-26/h2-13H,15-16H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | ZAKSPUQWJFWKKL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |