C16H14FNO4 — CID 2427280
[2-(3-methoxyanilino)-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2427280) has the molecular formula C16H14FNO4 and a molecular weight of 303.29 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] 2-fluorobenzoate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2427280 |
| Molecular Formula | C16H14FNO4 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] 2-fluorobenzoate |
| SMILES | COc1cccc(NC(=O)COC(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C16H14FNO4/c1-21-12-6-4-5-11(9-12)18-15(19)10-22-16(20)13-7-2-3-8-14(13)17/h2-9H,10H2,1H3,(H,18,19) |
| InChIKey | LIUULXCNDNKTED-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |