C26H18N4O3S — CID 16616552
(1-cyanoindolizin-2-yl)methyl 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate (PubChem CID 16616552) has the molecular formula C26H18N4O3S and a molecular weight of 466.52 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 16616552 |
| Molecular Formula | C26H18N4O3S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2-[2-(3-cyanoanilino)-2-oxoethyl]sulfanylbenzoate |
| SMILES | N#Cc1cccc(NC(=O)CSc2ccccc2C(=O)OCc2cn3ccccc3c2C#N)c1 |
| InChI | InChI=1S/C26H18N4O3S/c27-13-18-6-5-7-20(12-18)29-25(31)17-34-24-10-2-1-8-21(24)26(32)33-16-19-15-30-11-4-3-9-23(30)22(19)14-28/h1-12,15H,16-17H2,(H,29,31) |
| InChIKey | CESKYDKMLPWENM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |