C19H16N2O4 — CID 16616910
(1-cyanoindolizin-2-yl)methyl 2,3-dimethoxybenzoate (PubChem CID 16616910) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2,3-dimethoxybenzoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 16616910 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2,3-dimethoxybenzoate |
| SMILES | COc1cccc(C(=O)OCc2cn3ccccc3c2C#N)c1OC |
| InChI | InChI=1S/C19H16N2O4/c1-23-17-8-5-6-14(18(17)24-2)19(22)25-12-13-11-21-9-4-3-7-16(21)15(13)10-20/h3-9,11H,12H2,1-2H3 |
| InChIKey | RXFDQSPDIRAZNL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |