C21H21N3O4S — CID 42936749
(1-cyanoindolizin-2-yl)methyl 4-(butan-2-ylsulfamoyl)benzoate (PubChem CID 42936749) has the molecular formula C21H21N3O4S and a molecular weight of 411.48 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 4-(butan-2-ylsulfamoyl)benzoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 4-(butan-2-ylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42936749 |
| Molecular Formula | C21H21N3O4S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 4-(butan-2-ylsulfamoyl)benzoate |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)OCc2cn3ccccc3c2C#N)cc1 |
| InChI | InChI=1S/C21H21N3O4S/c1-3-15(2)23-29(26,27)18-9-7-16(8-10-18)21(25)28-14-17-13-24-11-5-4-6-20(24)19(17)12-22/h4-11,13,15,23H,3,14H2,1-2H3 |
| InChIKey | WTPFUCPMTPANNB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |