C23H23N3O4S — CID 55492197
(1-cyanoindolizin-2-yl)methyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 55492197) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 55492197 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(C(=O)OCc2cn3ccccc3c2C#N)cc1 |
| InChI | InChI=1S/C23H23N3O4S/c1-17-6-2-5-13-26(17)31(28,29)20-10-8-18(9-11-20)23(27)30-16-19-15-25-12-4-3-7-22(25)21(19)14-24/h3-4,7-12,15,17H,2,5-6,13,16H2,1H3 |
| InChIKey | OVQAVPUWFURZMT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |