C16H18N4O — CID 94017899
(2R)-1-[(1-cyanoindolizin-2-yl)methyl]piperidine-2-carboxamide (PubChem CID 94017899) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is (2R)-1-[(1-cyanoindolizin-2-yl)methyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-[(1-cyanoindolizin-2-yl)methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 94017899 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2R)-1-[(1-cyanoindolizin-2-yl)methyl]piperidine-2-carboxamide |
| SMILES | N#Cc1c(CN2CCCC[C@@H]2C(N)=O)cn2ccccc12 |
| InChI | InChI=1S/C16H18N4O/c17-9-13-12(10-19-7-3-1-5-14(13)19)11-20-8-4-2-6-15(20)16(18)21/h1,3,5,7,10,15H,2,4,6,8,11H2,(H2,18,21)/t15-/m1/s1 |
| InChIKey | AKHJZPSPSOQTTO-OAHLLOKOSA-N |
| XLogP | 1.65 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |