C14H17F3N2O — CID 95146043
(2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide (PubChem CID 95146043) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is (2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 95146043 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2S)-1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1CCCCN1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O/c15-14(16,17)11-6-2-1-5-10(11)9-19-8-4-3-7-12(19)13(18)20/h1-2,5-6,12H,3-4,7-9H2,(H2,18,20)/t12-/m0/s1 |
| InChIKey | WZNTXZMWBJPNDN-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |