C14H15F4NO2 — CID 129395291
(2S)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 129395291) has the molecular formula C14H15F4NO2 and a molecular weight of 305.27 g/mol. Its IUPAC name is (2S)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 129395291 |
| Molecular Formula | C14H15F4NO2 |
| Molecular Weight | 305.27 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | (2S)-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCCN1Cc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15F4NO2/c15-10-5-4-9(11(7-10)14(16,17)18)8-19-6-2-1-3-12(19)13(20)21/h4-5,7,12H,1-3,6,8H2,(H,20,21)/t12-/m0/s1 |
| InChIKey | JJGKYPGBANQTNB-LBPRGKRZSA-N |
| XLogP | 3.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |