C13H13F4NO2 — CID 122038870
(2S)-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122038870) has the molecular formula C13H13F4NO2 and a molecular weight of 291.24 g/mol. Its IUPAC name is (2S)-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122038870 |
| Molecular Formula | C13H13F4NO2 |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (2S)-1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F4NO2/c14-10-4-3-8(6-9(10)13(15,16)17)7-18-5-1-2-11(18)12(19)20/h3-4,6,11H,1-2,5,7H2,(H,19,20)/t11-/m0/s1 |
| InChIKey | FGOHXIUOJRFRRR-NSHDSACASA-N |
| XLogP | 2.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |