1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid

C13H15F2NO2 — CID 3500116

IUPAC1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCCN1Cc1cc(F)ccc1F
InChIInChI=1S/C13H15F2NO2/c14-10-4-5-11(15)9(7-10)8-16-6-2-1-3-12(16)13(17)18/h4-5,7,12H,1-3,6,8H2,(H,17,18)
InChIKeyGDWRIPXPMJFNDS-UHFFFAOYSA-N
MW255.26 g/mol
LogP2.40
Rot. Bonds3

About 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid

1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid (PubChem CID 3500116) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid.

Molecular Properties

Compound Name1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid
PubChem CID3500116
Molecular FormulaC13H15F2NO2
Molecular Weight255.26 g/mol
Exact Mass255.11
IUPAC Name1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid
SMILESO=C(O)C1CCCCN1Cc1cc(F)ccc1F
InChIInChI=1S/C13H15F2NO2/c14-10-4-5-11(15)9(7-10)8-16-6-2-1-3-12(16)13(17)18/h4-5,7,12H,1-3,6,8H2,(H,17,18)
InChIKeyGDWRIPXPMJFNDS-UHFFFAOYSA-N
XLogP2.40
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.26
LogP ≤ 52.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid?
The IUPAC name of 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid (CID 3500116) is 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid.
What is the SMILES notation for 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid?
The canonical SMILES for 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid is O=C(O)C1CCCCN1Cc1cc(F)ccc1F.
What is the InChIKey of 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid?
The InChIKey is GDWRIPXPMJFNDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO2/c14-10-4-5-11(15)9(7-10)8-16-6-2-1-3-12(16)13(17)18/h4-5,7,12H,1-3,6,8H2,(H,17,18).
What are the key properties of 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid?
1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid has a molecular weight of 255.26 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,5-difluorophenyl)methyl]piperidine-2-carboxylic acid is sourced from PubChem (CID 3500116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).