C15H19F2NO2 — CID 62215995
3-[1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]propanoic acid (PubChem CID 62215995) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-[1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]propanoic acid.
| Compound Name | 3-[1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 62215995 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-[1-[(2,5-difluorophenyl)methyl]piperidin-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCCN1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C15H19F2NO2/c16-12-4-6-14(17)11(9-12)10-18-8-2-1-3-13(18)5-7-15(19)20/h4,6,9,13H,1-3,5,7-8,10H2,(H,19,20) |
| InChIKey | GHTNNJLDARMJFT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |