C18H21N3O3 — CID 97238831
methyl (2S)-2-[1-[(1-cyanoindolizin-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate (PubChem CID 97238831) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl (2S)-2-[1-[(1-cyanoindolizin-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate.
| Compound Name | methyl (2S)-2-[1-[(1-cyanoindolizin-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 97238831 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | methyl (2S)-2-[1-[(1-cyanoindolizin-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate |
| SMILES | COC(=O)[C@@H](O)C1CCN(Cc2cn3ccccc3c2C#N)CC1 |
| InChI | InChI=1S/C18H21N3O3/c1-24-18(23)17(22)13-5-8-20(9-6-13)11-14-12-21-7-3-2-4-16(21)15(14)10-19/h2-4,7,12-13,17,22H,5-6,8-9,11H2,1H3/t17-/m0/s1 |
| InChIKey | GFRHIQIHQNPWQW-KRWDZBQOSA-N |
| XLogP | 1.56 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |