C13H18BrNO4 — CID 99833623
methyl (2R)-2-[1-[(5-bromofuran-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate (PubChem CID 99833623) has the molecular formula C13H18BrNO4 and a molecular weight of 332.19 g/mol. Its IUPAC name is methyl (2R)-2-[1-[(5-bromofuran-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate.
| Compound Name | methyl (2R)-2-[1-[(5-bromofuran-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 99833623 |
| Molecular Formula | C13H18BrNO4 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | methyl (2R)-2-[1-[(5-bromofuran-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate |
| SMILES | COC(=O)[C@H](O)C1CCN(Cc2ccc(Br)o2)CC1 |
| InChI | InChI=1S/C13H18BrNO4/c1-18-13(17)12(16)9-4-6-15(7-5-9)8-10-2-3-11(14)19-10/h2-3,9,12,16H,4-8H2,1H3/t12-/m1/s1 |
| InChIKey | NRCBAJPFWMDWKO-GFCCVEGCSA-N |
| XLogP | 1.79 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |