C13H18ClNO3S — CID 129403207
methyl (2S)-2-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate (PubChem CID 129403207) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is methyl (2S)-2-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate.
| Compound Name | methyl (2S)-2-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 129403207 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | methyl (2S)-2-[1-[(4-chlorothiophen-2-yl)methyl]piperidin-4-yl]-2-hydroxyacetate |
| SMILES | COC(=O)[C@@H](O)C1CCN(Cc2cc(Cl)cs2)CC1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-18-13(17)12(16)9-2-4-15(5-3-9)7-11-6-10(14)8-19-11/h6,8-9,12,16H,2-5,7H2,1H3/t12-/m0/s1 |
| InChIKey | WWGVLUHWPKQNQD-LBPRGKRZSA-N |
| XLogP | 2.15 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |