C21H24FNO5S — CID 7881604
2-(2-fluorophenoxy)ethyl 4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 7881604) has the molecular formula C21H24FNO5S and a molecular weight of 421.49 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7881604 |
| Molecular Formula | C21H24FNO5S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 4-[(2R)-2-methylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)c1ccc(C(=O)OCCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H24FNO5S/c1-16-6-4-5-13-23(16)29(25,26)18-11-9-17(10-12-18)21(24)28-15-14-27-20-8-3-2-7-19(20)22/h2-3,7-12,16H,4-6,13-15H2,1H3/t16-/m1/s1 |
| InChIKey | SBYKJLQPWYLXLF-MRXNPFEDSA-N |
| XLogP | 3.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|