C23H27NO6S — CID 42902941
2-(2-acetylphenoxy)ethyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 42902941) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-(2-acetylphenoxy)ethyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | 2-(2-acetylphenoxy)ethyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 42902941 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(2-acetylphenoxy)ethyl 4-(2-methylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC(=O)c1ccccc1OCCOC(=O)c1ccc(S(=O)(=O)N2CCCCC2C)cc1 |
| InChI | InChI=1S/C23H27NO6S/c1-17-7-5-6-14-24(17)31(27,28)20-12-10-19(11-13-20)23(26)30-16-15-29-22-9-4-3-8-21(22)18(2)25/h3-4,8-13,17H,5-7,14-16H2,1-2H3 |
| InChIKey | REXNIYNHOOKTNM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|