C23H19N3O4 — CID 55482263
(1-cyanoindolizin-2-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 55482263) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is (1-cyanoindolizin-2-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (1-cyanoindolizin-2-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 55482263 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (1-cyanoindolizin-2-yl)methyl 2-butyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)OCc3cn4ccccc4c3C#N)cc2C1=O |
| InChI | InChI=1S/C23H19N3O4/c1-2-3-10-26-21(27)17-8-7-15(11-18(17)22(26)28)23(29)30-14-16-13-25-9-5-4-6-20(25)19(16)12-24/h4-9,11,13H,2-3,10,14H2,1H3 |
| InChIKey | ZFJKROKQBONSSW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|